# Tylosin Splicing System Implementation Plan

> **For Claude:** REQUIRED SUB-SKILL: Use superpowers:executing-plans to implement this plan task-by-task.

**Goal:** Build a pipeline to splice SIME-identified fragments onto the Tylosin scaffold at positions 7, 15, and 16, and predict their antibacterial activity.

**Architecture:** A Python-based ETL pipeline using RDKit for structural manipulation (`macro_split`) and PyTorch for activity prediction (`SIME`).

**Tech Stack:** Python, RDKit, Pandas, PyTorch (SIME), Pytest.

---

### Task 1: Environment & Project Structure Setup

**Files:**
- Create: `scripts/tylosin_splicer.py` (Main entry point stub)
- Create: `src/splicing/__init__.py`
- Create: `src/splicing/scaffold_prep.py`
- Create: `tests/test_splicing.py`

**Step 1: Create directory structure**
```bash
mkdir -p src/splicing
touch src/splicing/__init__.py
```

**Step 2: Create a basic test to verify environment**
Write a test that imports both `macro_split` and `SIME` modules to ensure the workspace handles imports correctly.

```python
# tests/test_env_integration.py
import sys
import os
sys.path.append("/home/zly/project/SIME")  # Hack for now, will clean up later
sys.path.append("/home/zly/project/merge/macro_split")

def test_imports():
    from src.ring_numbering import get_macrolactone_numbering
    from utils.mole_predictor import ParallelBroadSpectrumPredictor
    assert True
```

**Step 3: Run test**
`pixi run pytest tests/test_env_integration.py`

---

### Task 2: Scaffold Preparation (The "Socket")

**Files:**
- Modify: `src/splicing/scaffold_prep.py`
- Test: `tests/test_scaffold_prep.py`

**Step 1: Write failing test**
Test that `prepare_tylosin_scaffold` returns a molecule with dummy atoms at positions 7, 15, and 16.

```python
# tests/test_scaffold_prep.py
from rdkit import Chem
from src.splicing.scaffold_prep import prepare_tylosin_scaffold

TYLOSIN_SMILES = "CCC1OC(=O)C(C)C(O)C(C)C(O)C(C)C(OC2CC(C)(O)C(O)C(C)O2)CC(C)C(=O)C=CC=C1COC3OS(C)C(O)C(N(C)C)C3O" # Simplified/Example

def test_scaffold_prep():
    scaffold, mapping = prepare_tylosin_scaffold(TYLOSIN_SMILES, positions=[7, 15, 16])
    # Check if we have mapped atoms
    assert 7 in mapping
    assert 15 in mapping
    assert 16 in mapping
    # Check if they are dummy atoms or have specific isotopes
```

**Step 2: Implement `prepare_tylosin_scaffold`**
Use `get_macrolactone_numbering` to find the atom indices.
Use `RWMol` to replace side chains at those indices with a dummy atom (e.g., At number 0 or Isotope).

**Step 3: Run tests**
`pixi run pytest tests/test_scaffold_prep.py`

---

### Task 3: Fragment Activation (The "Plug")

**Files:**
- Create: `src/splicing/fragment_prep.py`
- Test: `tests/test_fragment_prep.py`

**Step 1: Write failing test**
Test that `activate_fragment` takes a SMILES and returns a molecule with *one* attachment point.

```python
# tests/test_fragment_prep.py
from src.splicing.fragment_prep import activate_fragment

def test_activate_fragment_smart():
    # Fragment with -OH
    frag_smiles = "CCO"
    activated = activate_fragment(frag_smiles, strategy="smart")
    # Should find the O and replace H with attachment point
    assert "*" in Chem.MolToSmiles(activated)

def test_activate_fragment_random():
    frag_smiles = "CCCCC"
    activated = activate_fragment(frag_smiles, strategy="random")
    assert "*" in Chem.MolToSmiles(activated)
```

**Step 2: Implement `activate_fragment`**
- **Smart**: Look for -NH2, -OH, -SH. Use SMARTS to find them, replace a H with `*`.
- **Random**: Pick a random Carbon, replace a H with `*`.

**Step 3: Run tests**
`pixi run pytest tests/test_fragment_prep.py`

---

### Task 4: Splicing Engine (The Assembly)

**Files:**
- Create: `src/splicing/engine.py`
- Test: `tests/test_splicing_engine.py`

**Step 1: Write failing test**
Test connecting an activated fragment to the scaffold.

```python
def test_splice_molecules():
    scaffold = ... # prepared scaffold
    fragment = ... # activated fragment
    product = splice_molecule(scaffold, fragment, position=7)
    assert product is not None
    assert Chem.MolToSmiles(product) != Chem.MolToSmiles(scaffold)
```

**Step 2: Implement `splice_molecule`**
Use `Chem.ReplaceSubstructs` or `Chem.rdChemReactions`.
Ensure the connection is chemically valid.

**Step 3: Run tests**
`pixi run pytest tests/test_splicing_engine.py`

---

### Task 5: Prediction Pipeline Integration

**Files:**
- Create: `src/splicing/pipeline.py`
- Test: `tests/test_pipeline.py`

**Step 1: Write failing test (Mocked)**
Mock the SIME predictor to avoid loading heavy models during unit tests.

```python
def test_pipeline_flow(mocker):
    # Mock predictor
    mocker.patch('utils.mole_predictor.ParallelBroadSpectrumPredictor')

    frags = ["CCO", "CCN"]
    results = run_splicing_pipeline(TYLOSIN_SMILES, frags, positions=[7])
    assert len(results) > 0
```

**Step 2: Implement `run_splicing_pipeline`**
1. Prep scaffold.
2. Loop fragments -> activate -> splice.
3. Batch generate SMILES.
4. Call `ParallelBroadSpectrumPredictor`.
5. Return results.

**Step 3: Run tests**

---

### Task 6: CLI and Final Execution

**Files:**
- Create: `scripts/run_tylosin_optimization.py`

**Step 1: Implement CLI**
Arguments: `--input-scaffold`, `--fragment-csv`, `--positions`, `--output`.

**Step 2: Integration Test**
Run with a small subset of the fragment CSV (head -n 10).